What is the CAS number for Isoquinoline, 6-chloro- (6CI,9CI)?

The CAS number of Isoquinoline, 6-chloro- (6CI,9CI) is 62882-02-4.

What is Isoquinoline, 6-chloro- (6CI,9CI) (62882-02-4) used for?

Isoquinoline, 6-chloro(6CI,9CI), also known as 6-chloroisoquinoline, is a chloro-organic compound with the molecular formula C9H6ClN. It is a derivative of isoquinoline, an important heterocyclic compound with a fused pyridine-benzene ring structure. 6-chloroisoquinoline possesses potential therapeutic properties and is commonly used in organic synthesis and pharmaceutical research. Its unique chemical structure and properties make it a promising candidate for the development of new drugs, agrochemicals, dyes, pigments, and other industrial chemicals.InChI:InChI=1/C9H6ClN/c10-9-2-1-8-6-11-4-3-7(8)5-9/h1-6H

What is the CAS number for Isoquinoline, 6-chloro- (6CI,9CI)?

The CAS number of Isoquinoline, 6-chloro- (6CI,9CI) is 62882-02-4.

What is Isoquinoline, 6-chloro- (6CI,9CI) (62882-02-4) used for?

Isoquinoline, 6-chloro(6CI,9CI), also known as 6-chloroisoquinoline, is a chloro-organic compound with the molecular formula C9H6ClN. It is a derivative of isoquinoline, an important heterocyclic compound with a fused pyridine-benzene ring structure. 6-chloroisoquinoline possesses potential therapeutic properties and is commonly used in organic synthesis and pharmaceutical research. Its unique chemical structure and properties make it a promising candidate for the development of new drugs, agrochemicals, dyes, pigments, and other industrial chemicals.InChI:InChI=1/C9H6ClN/c10-9-2-1-8-6-11-4-3-7(8)5-9/h1-6H

Location:Home > Others

Isoquinoline, 6-chloro- (6CI,9CI)

CasNo 62882-02-4
Purity 99%

Inquery

Factory supply good quality Isoquinoline, 6-chloro- (6CI,9CI) 62882-02-4 with stock We supply high quality Isoquinoline, 6-chloro- (6CI,9CI) (CAS 62882-02-4), in stock, factory directly supply to clients, lower prices, more competitiveness.

What is the Isoquinoline, 6-chloro- (6CI,9CI) ?

Isoquinoline, 6-chloro- (6CI,9CI) is , while it's Molecular Formula is C9H6ClN. Used in Pharmaceutical Research and Development:
Isoquinoline, 6-chloro(6CI,9CI) is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and properties allow for the development of new drugs with potential therapeutic applications. Isoquinoline, 6-chloro(6CI,9CI)'s reactivity and versatility make it a valuable building block in medicinal chemistry.
Used in Agrochemical Development:
Isoquinoline, 6-chloro(6CI,9CI) is utilized in the development of agrochemicals, such as pesticides and herbicides. Its potential biological activity and chemical properties make it a promising candidate for the creation of new agrochemicals with improved efficacy and selectivity.
Used in Dye and Pigment Production:
Isoquinoline, 6-chloro(6CI,9CI) is employed in the production of dyes and pigments due to its color-forming properties. Its unique chemical structure allows for the creation of a wide range of colors, making it a valuable component in the dye and pigment industry.
Used in Organic Synthesis:
Isoquinoline, 6-chloro(6CI,9CI) is a versatile building block in organic synthesis, enabling the creation of various organic compounds with diverse applications. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules.
Used in Industrial Chemical Production:
Isoquinoline, 6-chloro(6CI,9CI) has potential applications in the production of various industrial chemicals, such as solvents, surfactants, and other specialty chemicals. Its unique properties and reactivity contribute to the development of innovative and high-performance industrial products.

How to get the best price on Isoquinoline, 6-chloro- (6CI,9CI)?

Hangzhou B&P Biotech Co,.Ltd is a quality supplier and manufacturer of Isoquinoline, 6-chloro- (6CI,9CI) . You can buy high quality, low price Isoquinoline, 6-chloro- (6CI,9CI) 62882-02-4 here. Contact us.